C25H26O5S — CID 11316572
(2S,3S)-2-(3,4-dimethoxyphenyl)-6-(methoxymethoxy)-3-methyl-5-phenylsulfanyl-2,3-dihydro-1-benzofuran (PubChem CID 11316572) has the molecular formula C25H26O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is (2S,3S)-2-(3,4-dimethoxyphenyl)-6-(methoxymethoxy)-3-methyl-5-phenylsulfanyl-2,3-dihydro-1-benzofuran.
| Compound Name | (2S,3S)-2-(3,4-dimethoxyphenyl)-6-(methoxymethoxy)-3-methyl-5-phenylsulfanyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 11316572 |
| Molecular Formula | C25H26O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (2S,3S)-2-(3,4-dimethoxyphenyl)-6-(methoxymethoxy)-3-methyl-5-phenylsulfanyl-2,3-dihydro-1-benzofuran |
| SMILES | COCOc1cc2c(cc1Sc1ccccc1)[C@H](C)[C@@H](c1ccc(OC)c(OC)c1)O2 |
| InChI | InChI=1S/C25H26O5S/c1-16-19-13-24(31-18-8-6-5-7-9-18)23(29-15-26-2)14-21(19)30-25(16)17-10-11-20(27-3)22(12-17)28-4/h5-14,16,25H,15H2,1-4H3/t16-,25-/m0/s1 |
| InChIKey | PRFKVJUZYGTPEL-LMKMVOKYSA-N |
| XLogP | 6.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|