C25H34N2O2 — CID 102242056
3,7-bis(2-methoxyethyl)-1,5-diphenyl-3,7-diazabicyclo[3.3.1]nonane (PubChem CID 102242056) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3,7-bis(2-methoxyethyl)-1,5-diphenyl-3,7-diazabicyclo[3.3.1]nonane.
| Compound Name | 3,7-bis(2-methoxyethyl)-1,5-diphenyl-3,7-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 102242056 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 3,7-bis(2-methoxyethyl)-1,5-diphenyl-3,7-diazabicyclo[3.3.1]nonane |
| SMILES | COCCN1CC2(c3ccccc3)CN(CCOC)CC(c3ccccc3)(C1)C2 |
| InChI | InChI=1S/C25H34N2O2/c1-28-15-13-26-18-24(22-9-5-3-6-10-22)17-25(19-26,23-11-7-4-8-12-23)21-27(20-24)14-16-29-2/h3-12H,13-21H2,1-2H3 |
| InChIKey | FNGPYTJQQXJMJX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |