C18H25N3O — CID 131651834
2-[2-(2-methoxyethyl)-7a-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]acetonitrile (PubChem CID 131651834) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[2-(2-methoxyethyl)-7a-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]acetonitrile.
| Compound Name | 2-[2-(2-methoxyethyl)-7a-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]acetonitrile |
|---|---|
| PubChem CID | 131651834 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-[2-(2-methoxyethyl)-7a-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]acetonitrile |
| SMILES | COCCN1CC2CN(CC#N)CCC2(c2ccccc2)C1 |
| InChI | InChI=1S/C18H25N3O/c1-22-12-11-21-14-17-13-20(10-8-19)9-7-18(17,15-21)16-5-3-2-4-6-16/h2-6,17H,7,9-15H2,1H3 |
| InChIKey | SUENDLHMGPHUAO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|