C18H22N4O2S — CID 124522369
[(3aS,7aR)-2-(2-hydroxyethyl)-7a-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(thiadiazol-4-yl)methanone (PubChem CID 124522369) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is [(3aS,7aR)-2-(2-hydroxyethyl)-7a-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [(3aS,7aR)-2-(2-hydroxyethyl)-7a-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 124522369 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [(3aS,7aR)-2-(2-hydroxyethyl)-7a-phenyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(thiadiazol-4-yl)methanone |
| SMILES | O=C(c1csnn1)N1CC[C@@]2(c3ccccc3)CN(CCO)C[C@H]2C1 |
| InChI | InChI=1S/C18H22N4O2S/c23-9-8-21-10-15-11-22(17(24)16-12-25-20-19-16)7-6-18(15,13-21)14-4-2-1-3-5-14/h1-5,12,15,23H,6-11,13H2/t15-,18-/m0/s1 |
| InChIKey | YHHZOOYRORRPJZ-YJBOKZPZSA-N |
| XLogP | 1.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |