C19H22N4OS — CID 124822780
[(3aR,7aR)-7a-phenyl-2-prop-2-enyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(thiadiazol-4-yl)methanone (PubChem CID 124822780) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is [(3aR,7aR)-7a-phenyl-2-prop-2-enyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [(3aR,7aR)-7a-phenyl-2-prop-2-enyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 124822780 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(3aR,7aR)-7a-phenyl-2-prop-2-enyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(thiadiazol-4-yl)methanone |
| SMILES | C=CCN1C[C@@H]2CN(C(=O)c3csnn3)CC[C@@]2(c2ccccc2)C1 |
| InChI | InChI=1S/C19H22N4OS/c1-2-9-22-11-16-12-23(18(24)17-13-25-21-20-17)10-8-19(16,14-22)15-6-4-3-5-7-15/h2-7,13,16H,1,8-12,14H2/t16-,19+/m1/s1 |
| InChIKey | XDLIRAXVOWNIIO-APWZRJJASA-N |
| XLogP | 2.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|