C22H30N2O4 — CID 72870065
(3aR,6aR)-2-(2-hydroxyethyl)-5-(1-phenylcyclohexanecarbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72870065) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (3aR,6aR)-2-(2-hydroxyethyl)-5-(1-phenylcyclohexanecarbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-(2-hydroxyethyl)-5-(1-phenylcyclohexanecarbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72870065 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (3aR,6aR)-2-(2-hydroxyethyl)-5-(1-phenylcyclohexanecarbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(N1C[C@H]2CN(CCO)C[C@@]2(C(=O)O)C1)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C22H30N2O4/c25-12-11-23-13-18-14-24(16-22(18,15-23)20(27)28)19(26)21(9-5-2-6-10-21)17-7-3-1-4-8-17/h1,3-4,7-8,18,25H,2,5-6,9-16H2,(H,27,28)/t18-,22-/m1/s1 |
| InChIKey | OFJOIRWUTDCMOP-XMSQKQJNSA-N |
| XLogP | 1.73 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |