C14H16F2O3S2 — CID 102243012
ethyl 2,2-difluoro-3-(4-methylphenyl)-3-methylsulfanylcarbothioyloxypropanoate (PubChem CID 102243012) has the molecular formula C14H16F2O3S2 and a molecular weight of 334.41 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-(4-methylphenyl)-3-methylsulfanylcarbothioyloxypropanoate.
| Compound Name | ethyl 2,2-difluoro-3-(4-methylphenyl)-3-methylsulfanylcarbothioyloxypropanoate |
|---|---|
| PubChem CID | 102243012 |
| Molecular Formula | C14H16F2O3S2 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | ethyl 2,2-difluoro-3-(4-methylphenyl)-3-methylsulfanylcarbothioyloxypropanoate |
| SMILES | CCOC(=O)C(F)(F)C(OC(=S)SC)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16F2O3S2/c1-4-18-12(17)14(15,16)11(19-13(20)21-3)10-7-5-9(2)6-8-10/h5-8,11H,4H2,1-3H3 |
| InChIKey | QQBPOJAFWGZKKC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|