C22H40O6P2 — CID 102244037
(6E)-4,4-bis(diethoxyphosphoryl)-7,11-dimethyldodeca-6,10-dien-1-yne (PubChem CID 102244037) has the molecular formula C22H40O6P2 and a molecular weight of 462.50 g/mol. Its IUPAC name is (6E)-4,4-bis(diethoxyphosphoryl)-7,11-dimethyldodeca-6,10-dien-1-yne.
| Compound Name | (6E)-4,4-bis(diethoxyphosphoryl)-7,11-dimethyldodeca-6,10-dien-1-yne |
|---|---|
| PubChem CID | 102244037 |
| Molecular Formula | C22H40O6P2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (6E)-4,4-bis(diethoxyphosphoryl)-7,11-dimethyldodeca-6,10-dien-1-yne |
| SMILES | C#CCC(C/C=C(\C)CCC=C(C)C)(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C22H40O6P2/c1-9-18-22(29(23,25-10-2)26-11-3,30(24,27-12-4)28-13-5)19-17-21(8)16-14-15-20(6)7/h1,15,17H,10-14,16,18-19H2,2-8H3/b21-17+ |
| InChIKey | JACYOALXFZZCOI-HEHNFIMWSA-N |
| XLogP | 7.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|