C38H25F3O5 — CID 102244539
(14R,15R)-14-(4-methoxyphenyl)-15-[4-(trifluoromethyl)phenyl]-12,17-dioxapentacyclo[16.8.0.02,11.03,8.021,26]hexacosa-1(18),2(11),3,5,7,9,19,21,23,25-decaene-13,16-dione (PubChem CID 102244539) has the molecular formula C38H25F3O5 and a molecular weight of 618.61 g/mol. Its IUPAC name is (14R,15R)-14-(4-methoxyphenyl)-15-[4-(trifluoromethyl)phenyl]-12,17-dioxapentacyclo[16.8.0.02,11.03,8.021,26]hexacosa-1(18),2(11),3,5,7,9,19,21,23,25-decaene-13,16-dione.
| Compound Name | (14R,15R)-14-(4-methoxyphenyl)-15-[4-(trifluoromethyl)phenyl]-12,17-dioxapentacyclo[16.8.0.02,11.03,8.021,26]hexacosa-1(18),2(11),3,5,7,9,19,21,23,25-decaene-13,16-dione |
|---|---|
| PubChem CID | 102244539 |
| Molecular Formula | C38H25F3O5 |
| Molecular Weight | 618.61 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | (14R,15R)-14-(4-methoxyphenyl)-15-[4-(trifluoromethyl)phenyl]-12,17-dioxapentacyclo[16.8.0.02,11.03,8.021,26]hexacosa-1(18),2(11),3,5,7,9,19,21,23,25-decaene-13,16-dione |
| SMILES | COc1ccc([C@@H]2C(=O)Oc3ccc4ccccc4c3-c3c(ccc4ccccc34)OC(=O)[C@H]2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C38H25F3O5/c1-44-27-18-12-25(13-19-27)33-32(24-10-16-26(17-11-24)38(39,40)41)36(42)45-30-20-14-22-6-2-4-8-28(22)34(30)35-29-9-5-3-7-23(29)15-21-31(35)46-37(33)43/h2-21,32-33H,1H3/t32-,33-/m0/s1 |
| InChIKey | ACVDIHLJLHHRBV-LQJZCPKCSA-N |
| XLogP | 9.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.61 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|