C11H16N2 — CID 102244722
5,7-dimethyl-3,4-dihydro-2H-quinolin-1-amine (PubChem CID 102244722) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 5,7-dimethyl-3,4-dihydro-2H-quinolin-1-amine.
| Compound Name | 5,7-dimethyl-3,4-dihydro-2H-quinolin-1-amine |
|---|---|
| PubChem CID | 102244722 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 5,7-dimethyl-3,4-dihydro-2H-quinolin-1-amine |
| SMILES | Cc1cc(C)c2c(c1)N(N)CCC2 |
| InChI | InChI=1S/C11H16N2/c1-8-6-9(2)10-4-3-5-13(12)11(10)7-8/h6-7H,3-5,12H2,1-2H3 |
| InChIKey | HLPAFXPLHCRDIM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|