C25H25N3O4 — CID 10224688
1-[2-(dimethylamino)ethyl]-3-(2,5-dioxo-3,4-diphenylpyrrol-1-yl)piperidine-2,6-dione (PubChem CID 10224688) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-(2,5-dioxo-3,4-diphenylpyrrol-1-yl)piperidine-2,6-dione.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-(2,5-dioxo-3,4-diphenylpyrrol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 10224688 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-(2,5-dioxo-3,4-diphenylpyrrol-1-yl)piperidine-2,6-dione |
| SMILES | CN(C)CCN1C(=O)CCC(N2C(=O)C(c3ccccc3)=C(c3ccccc3)C2=O)C1=O |
| InChI | InChI=1S/C25H25N3O4/c1-26(2)15-16-27-20(29)14-13-19(23(27)30)28-24(31)21(17-9-5-3-6-10-17)22(25(28)32)18-11-7-4-8-12-18/h3-12,19H,13-16H2,1-2H3 |
| InChIKey | AOPUCXJOQDSGGJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|