C7H9Cl — CID 102247778
3-chloro-1-methylcyclohexa-1,4-diene (PubChem CID 102247778) has the molecular formula C7H9Cl and a molecular weight of 128.60 g/mol. Its IUPAC name is 3-chloro-1-methylcyclohexa-1,4-diene.
| Compound Name | 3-chloro-1-methylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 102247778 |
| Molecular Formula | C7H9Cl |
| Molecular Weight | 128.60 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 3-chloro-1-methylcyclohexa-1,4-diene |
| SMILES | CC1=CC(Cl)C=CC1 |
| InChI | InChI=1S/C7H9Cl/c1-6-3-2-4-7(8)5-6/h2,4-5,7H,3H2,1H3 |
| InChIKey | TULMXRMSGBBOPS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|