C21H30N4O6 — CID 10224880
N-hydroxy-N-[(2R)-2-[[[1-(2-hydroxyacetyl)-3,4-dihydro-2H-quinoline-6-carbonyl]amino]carbamoyl]heptyl]formamide (PubChem CID 10224880) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is N-hydroxy-N-[(2R)-2-[[[1-(2-hydroxyacetyl)-3,4-dihydro-2H-quinoline-6-carbonyl]amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[(2R)-2-[[[1-(2-hydroxyacetyl)-3,4-dihydro-2H-quinoline-6-carbonyl]amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 10224880 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-hydroxy-N-[(2R)-2-[[[1-(2-hydroxyacetyl)-3,4-dihydro-2H-quinoline-6-carbonyl]amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNC(=O)c1ccc2c(c1)CCCN2C(=O)CO |
| InChI | InChI=1S/C21H30N4O6/c1-2-3-4-6-17(12-24(31)14-27)21(30)23-22-20(29)16-8-9-18-15(11-16)7-5-10-25(18)19(28)13-26/h8-9,11,14,17,26,31H,2-7,10,12-13H2,1H3,(H,22,29)(H,23,30)/t17-/m1/s1 |
| InChIKey | FYZKHXWKAAMKMT-QGZVFWFLSA-N |
| XLogP | 0.76 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|