C27H43N3O6 — CID 142043190
2-[[formyl(hydroxy)amino]methyl]-N-[2-[4-(4-methoxybenzoyl)piperidin-1-yl]-2-oxoethyl]hexanamide;2-methylpropane (PubChem CID 142043190) has the molecular formula C27H43N3O6 and a molecular weight of 505.66 g/mol. Its IUPAC name is 2-[[formyl(hydroxy)amino]methyl]-N-[2-[4-(4-methoxybenzoyl)piperidin-1-yl]-2-oxoethyl]hexanamide;2-methylpropane.
| Compound Name | 2-[[formyl(hydroxy)amino]methyl]-N-[2-[4-(4-methoxybenzoyl)piperidin-1-yl]-2-oxoethyl]hexanamide;2-methylpropane |
|---|---|
| PubChem CID | 142043190 |
| Molecular Formula | C27H43N3O6 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 2-[[formyl(hydroxy)amino]methyl]-N-[2-[4-(4-methoxybenzoyl)piperidin-1-yl]-2-oxoethyl]hexanamide;2-methylpropane |
| SMILES | CC(C)C.CCCCC(CN(O)C=O)C(=O)NCC(=O)N1CCC(C(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H33N3O6.C4H10/c1-3-4-5-19(15-26(31)16-27)23(30)24-14-21(28)25-12-10-18(11-13-25)22(29)17-6-8-20(32-2)9-7-17;1-4(2)3/h6-9,16,18-19,31H,3-5,10-15H2,1-2H3,(H,24,30);4H,1-3H3 |
| InChIKey | BVWPHRRRGXLPKD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|