C28H44N4O8 — CID 143426513
N-[1-[2-[[(2R)-2-[[formyl(hydroxy)amino]methyl]-4-methyloctanoyl]amino]acetyl]piperidin-4-yl]-3,4,5-trimethoxybenzamide (PubChem CID 143426513) has the molecular formula C28H44N4O8 and a molecular weight of 564.68 g/mol. Its IUPAC name is N-[1-[2-[[(2R)-2-[[formyl(hydroxy)amino]methyl]-4-methyloctanoyl]amino]acetyl]piperidin-4-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-[2-[[(2R)-2-[[formyl(hydroxy)amino]methyl]-4-methyloctanoyl]amino]acetyl]piperidin-4-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 143426513 |
| Molecular Formula | C28H44N4O8 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | N-[1-[2-[[(2R)-2-[[formyl(hydroxy)amino]methyl]-4-methyloctanoyl]amino]acetyl]piperidin-4-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCCCC(C)C[C@H](CN(O)C=O)C(=O)NCC(=O)N1CCC(NC(=O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C28H44N4O8/c1-6-7-8-19(2)13-21(17-32(37)18-33)27(35)29-16-25(34)31-11-9-22(10-12-31)30-28(36)20-14-23(38-3)26(40-5)24(15-20)39-4/h14-15,18-19,21-22,37H,6-13,16-17H2,1-5H3,(H,29,35)(H,30,36)/t19?,21-/m1/s1 |
| InChIKey | MJHDBTIFVFRIDL-VGAJERRHSA-N |
| XLogP | 2.23 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|