C14H24O3 — CID 102250136
propan-2-yl (2R,3S)-3-ethenyl-2-hydroxy-2-prop-1-en-2-ylhexanoate (PubChem CID 102250136) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is propan-2-yl (2R,3S)-3-ethenyl-2-hydroxy-2-prop-1-en-2-ylhexanoate.
| Compound Name | propan-2-yl (2R,3S)-3-ethenyl-2-hydroxy-2-prop-1-en-2-ylhexanoate |
|---|---|
| PubChem CID | 102250136 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | propan-2-yl (2R,3S)-3-ethenyl-2-hydroxy-2-prop-1-en-2-ylhexanoate |
| SMILES | C=C[C@H](CCC)[C@@](O)(C(=C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C14H24O3/c1-7-9-12(8-2)14(16,10(3)4)13(15)17-11(5)6/h8,11-12,16H,2-3,7,9H2,1,4-6H3/t12-,14+/m1/s1 |
| InChIKey | GICWACIYAJFFEF-OCCSQVGLSA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|