C15H26O3 — CID 102021709
propan-2-yl (3S,4S)-4-ethenyl-2-oxo-3-propylheptanoate (PubChem CID 102021709) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is propan-2-yl (3S,4S)-4-ethenyl-2-oxo-3-propylheptanoate.
| Compound Name | propan-2-yl (3S,4S)-4-ethenyl-2-oxo-3-propylheptanoate |
|---|---|
| PubChem CID | 102021709 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | propan-2-yl (3S,4S)-4-ethenyl-2-oxo-3-propylheptanoate |
| SMILES | C=C[C@H](CCC)[C@H](CCC)C(=O)C(=O)OC(C)C |
| InChI | InChI=1S/C15H26O3/c1-6-9-12(8-3)13(10-7-2)14(16)15(17)18-11(4)5/h8,11-13H,3,6-7,9-10H2,1-2,4-5H3/t12-,13+/m1/s1 |
| InChIKey | CTJLPQVEINPNDJ-OLZOCXBDSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|