C17H26O3 — CID 102251092
tert-butyl (1R,3S,4R,5S)-1,4,5-trimethyl-9-oxobicyclo[3.3.1]non-6-ene-3-carboxylate (PubChem CID 102251092) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is tert-butyl (1R,3S,4R,5S)-1,4,5-trimethyl-9-oxobicyclo[3.3.1]non-6-ene-3-carboxylate.
| Compound Name | tert-butyl (1R,3S,4R,5S)-1,4,5-trimethyl-9-oxobicyclo[3.3.1]non-6-ene-3-carboxylate |
|---|---|
| PubChem CID | 102251092 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | tert-butyl (1R,3S,4R,5S)-1,4,5-trimethyl-9-oxobicyclo[3.3.1]non-6-ene-3-carboxylate |
| SMILES | C[C@@H]1[C@@H](C(=O)OC(C)(C)C)C[C@@]2(C)CC=C[C@]1(C)C2=O |
| InChI | InChI=1S/C17H26O3/c1-11-12(13(18)20-15(2,3)4)10-16(5)8-7-9-17(11,6)14(16)19/h7,9,11-12H,8,10H2,1-6H3/t11-,12+,16-,17+/m1/s1 |
| InChIKey | KJEUEHJZQGLEGW-AWBCAMRRSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|