C16H24O3 — CID 101382424
tert-butyl (1R,3S,5R)-1,5-dimethyl-9-oxobicyclo[3.3.1]non-6-ene-3-carboxylate (PubChem CID 101382424) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is tert-butyl (1R,3S,5R)-1,5-dimethyl-9-oxobicyclo[3.3.1]non-6-ene-3-carboxylate.
| Compound Name | tert-butyl (1R,3S,5R)-1,5-dimethyl-9-oxobicyclo[3.3.1]non-6-ene-3-carboxylate |
|---|---|
| PubChem CID | 101382424 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | tert-butyl (1R,3S,5R)-1,5-dimethyl-9-oxobicyclo[3.3.1]non-6-ene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@@]2(C)CC=C[C@@](C)(C1)C2=O |
| InChI | InChI=1S/C16H24O3/c1-14(2,3)19-12(17)11-9-15(4)7-6-8-16(5,10-11)13(15)18/h6-7,11H,8-10H2,1-5H3/t11-,15+,16-/m1/s1 |
| InChIKey | SLOAFRAZIMTNEK-XFBWCDHKSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|