C25H27NO5 — CID 102251123
ethyl 1-benzyl-4-[(3-methoxycarbonylphenyl)methyl]-5,5-dimethyl-2-oxopyrrole-3-carboxylate (PubChem CID 102251123) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is ethyl 1-benzyl-4-[(3-methoxycarbonylphenyl)methyl]-5,5-dimethyl-2-oxopyrrole-3-carboxylate.
| Compound Name | ethyl 1-benzyl-4-[(3-methoxycarbonylphenyl)methyl]-5,5-dimethyl-2-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102251123 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | ethyl 1-benzyl-4-[(3-methoxycarbonylphenyl)methyl]-5,5-dimethyl-2-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(Cc2cccc(C(=O)OC)c2)C(C)(C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C25H27NO5/c1-5-31-24(29)21-20(15-18-12-9-13-19(14-18)23(28)30-4)25(2,3)26(22(21)27)16-17-10-7-6-8-11-17/h6-14H,5,15-16H2,1-4H3 |
| InChIKey | LVXSBVYPPWDBBU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|