C15H21NO6S — CID 102253744
[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonylanilino]methyl acetate (PubChem CID 102253744) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is [N-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonylanilino]methyl acetate.
| Compound Name | [N-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonylanilino]methyl acetate |
|---|---|
| PubChem CID | 102253744 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [N-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonylanilino]methyl acetate |
| SMILES | CC(=O)OCN(C(=O)OC(C)(C)C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H21NO6S/c1-11(17)21-10-16(14(18)22-15(2,3)4)12-6-8-13(9-7-12)23(5,19)20/h6-9H,10H2,1-5H3 |
| InChIKey | CDUYZFQHBBCBQL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|