C14H21N3O5S — CID 157047827
tert-butyl N-(2-amino-2-hydroxyiminoethyl)-N-(4-methylsulfonylphenyl)carbamate (PubChem CID 157047827) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is tert-butyl N-(2-amino-2-hydroxyiminoethyl)-N-(4-methylsulfonylphenyl)carbamate.
| Compound Name | tert-butyl N-(2-amino-2-hydroxyiminoethyl)-N-(4-methylsulfonylphenyl)carbamate |
|---|---|
| PubChem CID | 157047827 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | tert-butyl N-(2-amino-2-hydroxyiminoethyl)-N-(4-methylsulfonylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(N)=NO)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21N3O5S/c1-14(2,3)22-13(18)17(9-12(15)16-19)10-5-7-11(8-6-10)23(4,20)21/h5-8,19H,9H2,1-4H3,(H2,15,16) |
| InChIKey | QGKMFRYNEPSINW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|