C31H40N2O8S — CID 118565467
tert-butyl N-(2-methoxyethoxymethyl)-N-[4-[2-methoxyethoxymethyl-(2-phenylphenyl)sulfonylamino]phenyl]carbamate (PubChem CID 118565467) has the molecular formula C31H40N2O8S and a molecular weight of 600.73 g/mol. Its IUPAC name is tert-butyl N-(2-methoxyethoxymethyl)-N-[4-[2-methoxyethoxymethyl-(2-phenylphenyl)sulfonylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-(2-methoxyethoxymethyl)-N-[4-[2-methoxyethoxymethyl-(2-phenylphenyl)sulfonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 118565467 |
| Molecular Formula | C31H40N2O8S |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | tert-butyl N-(2-methoxyethoxymethyl)-N-[4-[2-methoxyethoxymethyl-(2-phenylphenyl)sulfonylamino]phenyl]carbamate |
| SMILES | COCCOCN(C(=O)OC(C)(C)C)c1ccc(N(COCCOC)S(=O)(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H40N2O8S/c1-31(2,3)41-30(34)32(23-39-21-19-37-4)26-15-17-27(18-16-26)33(24-40-22-20-38-5)42(35,36)29-14-10-9-13-28(29)25-11-7-6-8-12-25/h6-18H,19-24H2,1-5H3 |
| InChIKey | VFMUGBVCLCZMDG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|