C30H32N4O5S — CID 141234150
N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 141234150) has the molecular formula C30H32N4O5S and a molecular weight of 560.68 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141234150 |
| Molecular Formula | C30H32N4O5S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)-2-[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | COCCOCN(c1onc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(Cn2c(C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H32N4O5S/c1-21-22(2)32-39-30(21)34(20-38-18-17-37-4)40(35,36)29-12-8-5-9-26(29)25-15-13-24(14-16-25)19-33-23(3)31-27-10-6-7-11-28(27)33/h5-16H,17-20H2,1-4H3 |
| InChIKey | OAQXFJDPZULHHO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 99.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|