C37H52N4O6SSi — CID 22574960
ethyl 3-[[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-3-ethylphenyl]methyl]-5-ethyl-2-propylimidazole-4-carboxylate (PubChem CID 22574960) has the molecular formula C37H52N4O6SSi and a molecular weight of 709.00 g/mol. Its IUPAC name is ethyl 3-[[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-3-ethylphenyl]methyl]-5-ethyl-2-propylimidazole-4-carboxylate.
| Compound Name | ethyl 3-[[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-3-ethylphenyl]methyl]-5-ethyl-2-propylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 22574960 |
| Molecular Formula | C37H52N4O6SSi |
| Molecular Weight | 709.00 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | ethyl 3-[[4-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-3-ethylphenyl]methyl]-5-ethyl-2-propylimidazole-4-carboxylate |
| SMILES | CCCc1nc(CC)c(C(=O)OCC)n1Cc1ccc(-c2ccccc2S(=O)(=O)N(COCC[Si](C)(C)C)c2onc(C)c2C)c(CC)c1 |
| InChI | InChI=1S/C37H52N4O6SSi/c1-10-16-34-38-32(12-3)35(37(42)46-13-4)40(34)24-28-19-20-30(29(11-2)23-28)31-17-14-15-18-33(31)48(43,44)41(25-45-21-22-49(7,8)9)36-26(5)27(6)39-47-36/h14-15,17-20,23H,10-13,16,21-22,24-25H2,1-9H3 |
| InChIKey | CFORIZBGYQBDTH-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 116.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.00 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|