C16H34O4Si — CID 102255367
(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)butanal (PubChem CID 102255367) has the molecular formula C16H34O4Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)butanal.
| Compound Name | (2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)butanal |
|---|---|
| PubChem CID | 102255367 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-di(propan-2-yloxy)butanal |
| SMILES | CC(C)O[C@@H](C=O)[C@H](CO[Si](C)(C)C(C)(C)C)OC(C)C |
| InChI | InChI=1S/C16H34O4Si/c1-12(2)19-14(10-17)15(20-13(3)4)11-18-21(8,9)16(5,6)7/h10,12-15H,11H2,1-9H3/t14-,15-/m0/s1 |
| InChIKey | GJGKXDZMIWEGDR-GJZGRUSLSA-N |
| XLogP | 3.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|