C18H22F3NO3 — CID 102257840
prop-2-enyl (2R)-2-[[(1R)-2-methoxy-1-phenylethyl]amino]-2-(trifluoromethyl)pent-4-enoate (PubChem CID 102257840) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-[[(1R)-2-methoxy-1-phenylethyl]amino]-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | prop-2-enyl (2R)-2-[[(1R)-2-methoxy-1-phenylethyl]amino]-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 102257840 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | prop-2-enyl (2R)-2-[[(1R)-2-methoxy-1-phenylethyl]amino]-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=CCOC(=O)[C@@](CC=C)(N[C@@H](COC)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H22F3NO3/c1-4-11-17(18(19,20)21,16(23)25-12-5-2)22-15(13-24-3)14-9-7-6-8-10-14/h4-10,15,22H,1-2,11-13H2,3H3/t15-,17+/m0/s1 |
| InChIKey | AFUNKVBBYZORNP-DOTOQJQBSA-N |
| XLogP | 3.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|