C22H23F2NO3 — CID 101409764
benzyl 3,3-difluoro-2-[(1R)-2-methoxy-1-phenylethyl]iminohex-5-enoate (PubChem CID 101409764) has the molecular formula C22H23F2NO3 and a molecular weight of 387.43 g/mol. Its IUPAC name is benzyl 3,3-difluoro-2-[(1R)-2-methoxy-1-phenylethyl]iminohex-5-enoate.
| Compound Name | benzyl 3,3-difluoro-2-[(1R)-2-methoxy-1-phenylethyl]iminohex-5-enoate |
|---|---|
| PubChem CID | 101409764 |
| Molecular Formula | C22H23F2NO3 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | benzyl 3,3-difluoro-2-[(1R)-2-methoxy-1-phenylethyl]iminohex-5-enoate |
| SMILES | C=CCC(F)(F)/C(=N/[C@@H](COC)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23F2NO3/c1-3-14-22(23,24)20(21(26)28-15-17-10-6-4-7-11-17)25-19(16-27-2)18-12-8-5-9-13-18/h3-13,19H,1,14-16H2,2H3/b25-20+/t19-/m0/s1 |
| InChIKey | LIKXKOPNVVYSHV-UINQJLALSA-N |
| XLogP | 4.77 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|