C19H23F2NO4 — CID 23659865
[(2R)-3,3-difluoro-2-(phenylmethoxycarbonylamino)hex-5-enyl] pent-4-enoate (PubChem CID 23659865) has the molecular formula C19H23F2NO4 and a molecular weight of 367.39 g/mol. Its IUPAC name is [(2R)-3,3-difluoro-2-(phenylmethoxycarbonylamino)hex-5-enyl] pent-4-enoate.
| Compound Name | [(2R)-3,3-difluoro-2-(phenylmethoxycarbonylamino)hex-5-enyl] pent-4-enoate |
|---|---|
| PubChem CID | 23659865 |
| Molecular Formula | C19H23F2NO4 |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [(2R)-3,3-difluoro-2-(phenylmethoxycarbonylamino)hex-5-enyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@@H](NC(=O)OCc1ccccc1)C(F)(F)CC=C |
| InChI | InChI=1S/C19H23F2NO4/c1-3-5-11-17(23)25-14-16(19(20,21)12-4-2)22-18(24)26-13-15-9-7-6-8-10-15/h3-4,6-10,16H,1-2,5,11-14H2,(H,22,24)/t16-/m1/s1 |
| InChIKey | XLWGQSNYNZDESO-MRXNPFEDSA-N |
| XLogP | 4.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|