C17H20O8 — CID 102258168
trimethyl 7,7-dimethyl-5-oxo-6,8-dihydro-2H-chromene-2,3,4-tricarboxylate (PubChem CID 102258168) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is trimethyl 7,7-dimethyl-5-oxo-6,8-dihydro-2H-chromene-2,3,4-tricarboxylate.
| Compound Name | trimethyl 7,7-dimethyl-5-oxo-6,8-dihydro-2H-chromene-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 102258168 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | trimethyl 7,7-dimethyl-5-oxo-6,8-dihydro-2H-chromene-2,3,4-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C17H20O8/c1-17(2)6-8(18)10-9(7-17)25-13(16(21)24-5)12(15(20)23-4)11(10)14(19)22-3/h13H,6-7H2,1-5H3 |
| InChIKey | XANIABVFPPFSTO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|