C23H29Cl2N3O2 — CID 10225840
3,4-dichloro-N-[1-[4-[3-(dimethylamino)propoxy]phenyl]piperidin-4-yl]benzamide (PubChem CID 10225840) has the molecular formula C23H29Cl2N3O2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-[4-[3-(dimethylamino)propoxy]phenyl]piperidin-4-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[1-[4-[3-(dimethylamino)propoxy]phenyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 10225840 |
| Molecular Formula | C23H29Cl2N3O2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3,4-dichloro-N-[1-[4-[3-(dimethylamino)propoxy]phenyl]piperidin-4-yl]benzamide |
| SMILES | CN(C)CCCOc1ccc(N2CCC(NC(=O)c3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C23H29Cl2N3O2/c1-27(2)12-3-15-30-20-7-5-19(6-8-20)28-13-10-18(11-14-28)26-23(29)17-4-9-21(24)22(25)16-17/h4-9,16,18H,3,10-15H2,1-2H3,(H,26,29) |
| InChIKey | KLZULNACUNTPIU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|