C34H37N3O6S3 — CID 102258481
(1S,2S)-4,9,14-tris-(4-methylphenyl)sulfonyl-4,9,14-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-6,11-diene (PubChem CID 102258481) has the molecular formula C34H37N3O6S3 and a molecular weight of 679.89 g/mol. Its IUPAC name is (1S,2S)-4,9,14-tris-(4-methylphenyl)sulfonyl-4,9,14-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-6,11-diene.
| Compound Name | (1S,2S)-4,9,14-tris-(4-methylphenyl)sulfonyl-4,9,14-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-6,11-diene |
|---|---|
| PubChem CID | 102258481 |
| Molecular Formula | C34H37N3O6S3 |
| Molecular Weight | 679.89 g/mol |
| Exact Mass | 679.18 |
| IUPAC Name | (1S,2S)-4,9,14-tris-(4-methylphenyl)sulfonyl-4,9,14-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-6,11-diene |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C4CN(S(=O)(=O)c5ccc(C)cc5)CC[C@H]4[C@@H]4CN(S(=O)(=O)c5ccc(C)cc5)CC4=C3C2)cc1 |
| InChI | InChI=1S/C34H37N3O6S3/c1-23-4-10-26(11-5-23)44(38,39)35-17-16-29-30(18-35)32-20-37(46(42,43)28-14-8-25(3)9-15-28)22-34(32)33-21-36(19-31(29)33)45(40,41)27-12-6-24(2)7-13-27/h4-15,29,31H,16-22H2,1-3H3/t29-,31+/m1/s1 |
| InChIKey | XOLKIDMFSJZNAT-VEEOACQBSA-N |
| XLogP | 4.25 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |