C9H10F2N2O3S — CID 102258947
ethyl 2-(2-acetamido-1,3-thiazol-5-yl)-2,2-difluoroacetate (PubChem CID 102258947) has the molecular formula C9H10F2N2O3S and a molecular weight of 264.25 g/mol. Its IUPAC name is ethyl 2-(2-acetamido-1,3-thiazol-5-yl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(2-acetamido-1,3-thiazol-5-yl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 102258947 |
| Molecular Formula | C9H10F2N2O3S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | ethyl 2-(2-acetamido-1,3-thiazol-5-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C9H10F2N2O3S/c1-3-16-7(15)9(10,11)6-4-12-8(17-6)13-5(2)14/h4H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | KERLIKNWBKLLTK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |