C9H11F3N2O2S — CID 172594699
ethyl 2-(2-amino-1,3-thiazol-5-yl)-4,4,4-trifluorobutanoate (PubChem CID 172594699) has the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. Its IUPAC name is ethyl 2-(2-amino-1,3-thiazol-5-yl)-4,4,4-trifluorobutanoate.
| Compound Name | ethyl 2-(2-amino-1,3-thiazol-5-yl)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 172594699 |
| Molecular Formula | C9H11F3N2O2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | ethyl 2-(2-amino-1,3-thiazol-5-yl)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C(CC(F)(F)F)c1cnc(N)s1 |
| InChI | InChI=1S/C9H11F3N2O2S/c1-2-16-7(15)5(3-9(10,11)12)6-4-14-8(13)17-6/h4-5H,2-3H2,1H3,(H2,13,14) |
| InChIKey | FKGABGSFQFOSHP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |