C9H10F3NO2S — CID 106784042
methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate (PubChem CID 106784042) has the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. Its IUPAC name is methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate.
| Compound Name | methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 106784042 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]butanoate |
| SMILES | CCC(C(=O)OC)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H10F3NO2S/c1-3-5(7(14)15-2)6-4-13-8(16-6)9(10,11)12/h4-5H,3H2,1-2H3 |
| InChIKey | AQCWDXSGMRUBKG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |