C11H14F3NO2S — CID 106784049
ethyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentanoate (PubChem CID 106784049) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is ethyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentanoate.
| Compound Name | ethyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentanoate |
|---|---|
| PubChem CID | 106784049 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | ethyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentanoate |
| SMILES | CCCC(C(=O)OCC)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-3-5-7(9(16)17-4-2)8-6-15-10(18-8)11(12,13)14/h6-7H,3-5H2,1-2H3 |
| InChIKey | KLHVQRLMHCLFDT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |