C18H26N2O2 — CID 10225976
1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-phenylpiperazine (PubChem CID 10225976) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-phenylpiperazine.
| Compound Name | 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 10225976 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]-4-phenylpiperazine |
| SMILES | c1ccc(N2CCN(C[C@H]3COC4(CCCC4)O3)CC2)cc1 |
| InChI | InChI=1S/C18H26N2O2/c1-2-6-16(7-3-1)20-12-10-19(11-13-20)14-17-15-21-18(22-17)8-4-5-9-18/h1-3,6-7,17H,4-5,8-15H2/t17-/m0/s1 |
| InChIKey | PAHFITBUFKCNRX-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |