C20H36N4OSi2 — CID 615256
5-[(4-phenylpiperazin-1-yl)methyl]-N,N-bis(trimethylsilyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 615256) has the molecular formula C20H36N4OSi2 and a molecular weight of 404.71 g/mol. Its IUPAC name is 5-[(4-phenylpiperazin-1-yl)methyl]-N,N-bis(trimethylsilyl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 5-[(4-phenylpiperazin-1-yl)methyl]-N,N-bis(trimethylsilyl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 615256 |
| Molecular Formula | C20H36N4OSi2 |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 5-[(4-phenylpiperazin-1-yl)methyl]-N,N-bis(trimethylsilyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | C[Si](C)(C)N(C1=NCC(CN2CCN(c3ccccc3)CC2)O1)[Si](C)(C)C |
| InChI | InChI=1S/C20H36N4OSi2/c1-26(2,3)24(27(4,5)6)20-21-16-19(25-20)17-22-12-14-23(15-13-22)18-10-8-7-9-11-18/h7-11,19H,12-17H2,1-6H3 |
| InChIKey | FDHMECFNIDVTNZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|