C27H29O3S+ — CID 140699184
[4-(1,4-dioxaspiro[4.5]decan-3-ylmethoxy)phenyl]-diphenylsulfanium (PubChem CID 140699184) has the molecular formula C27H29O3S+ and a molecular weight of 433.59 g/mol. Its IUPAC name is [4-(1,4-dioxaspiro[4.5]decan-3-ylmethoxy)phenyl]-diphenylsulfanium.
| Compound Name | [4-(1,4-dioxaspiro[4.5]decan-3-ylmethoxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140699184 |
| Molecular Formula | C27H29O3S+ |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [4-(1,4-dioxaspiro[4.5]decan-3-ylmethoxy)phenyl]-diphenylsulfanium |
| SMILES | c1ccc([S+](c2ccccc2)c2ccc(OCC3COC4(CCCCC4)O3)cc2)cc1 |
| InChI | InChI=1S/C27H29O3S/c1-4-10-24(11-5-1)31(25-12-6-2-7-13-25)26-16-14-22(15-17-26)28-20-23-21-29-27(30-23)18-8-3-9-19-27/h1-2,4-7,10-17,23H,3,8-9,18-21H2/q+1 |
| InChIKey | CCLQMLVCWKJWIS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|