C14H18O4 — CID 102260144
(1R,3R,7S,12R)-3-methoxy-4,9-dioxatetracyclo[9.3.1.03,12.07,12]pentadec-13-en-2-one (PubChem CID 102260144) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (1R,3R,7S,12R)-3-methoxy-4,9-dioxatetracyclo[9.3.1.03,12.07,12]pentadec-13-en-2-one.
| Compound Name | (1R,3R,7S,12R)-3-methoxy-4,9-dioxatetracyclo[9.3.1.03,12.07,12]pentadec-13-en-2-one |
|---|---|
| PubChem CID | 102260144 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (1R,3R,7S,12R)-3-methoxy-4,9-dioxatetracyclo[9.3.1.03,12.07,12]pentadec-13-en-2-one |
| SMILES | CO[C@@]12OCC[C@@H]3COCC4C[C@H](C=C[C@@]431)C2=O |
| InChI | InChI=1S/C14H18O4/c1-16-14-12(15)9-2-4-13(14)10(3-5-18-14)7-17-8-11(13)6-9/h2,4,9-11H,3,5-8H2,1H3/t9-,10+,11?,13-,14-/m0/s1 |
| InChIKey | OEBXCJFGQVKLJV-YAXLDAKKSA-N |
| XLogP | 1.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|