C13H16O5 — CID 134957032
(1S,6S)-10,10-dimethoxy-4-oxatricyclo[6.2.2.01,6]dodec-11-ene-5,9-dione (PubChem CID 134957032) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (1S,6S)-10,10-dimethoxy-4-oxatricyclo[6.2.2.01,6]dodec-11-ene-5,9-dione.
| Compound Name | (1S,6S)-10,10-dimethoxy-4-oxatricyclo[6.2.2.01,6]dodec-11-ene-5,9-dione |
|---|---|
| PubChem CID | 134957032 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (1S,6S)-10,10-dimethoxy-4-oxatricyclo[6.2.2.01,6]dodec-11-ene-5,9-dione |
| SMILES | COC1(OC)C(=O)C2C=C[C@]13CCOC(=O)[C@H]3C2 |
| InChI | InChI=1S/C13H16O5/c1-16-13(17-2)10(14)8-3-4-12(13)5-6-18-11(15)9(12)7-8/h3-4,8-9H,5-7H2,1-2H3/t8?,9-,12-/m1/s1 |
| InChIKey | QAWZJKWJVAIYEO-LHYZIERNSA-N |
| XLogP | 0.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|