C20H30O5 — CID 122201892
ethyl (1S,2S,7R,8S,10S)-10-(methoxymethyl)-4,4-dimethyl-1-prop-2-enyl-3,5-dioxatricyclo[6.2.2.02,7]dodec-11-ene-10-carboxylate (PubChem CID 122201892) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl (1S,2S,7R,8S,10S)-10-(methoxymethyl)-4,4-dimethyl-1-prop-2-enyl-3,5-dioxatricyclo[6.2.2.02,7]dodec-11-ene-10-carboxylate.
| Compound Name | ethyl (1S,2S,7R,8S,10S)-10-(methoxymethyl)-4,4-dimethyl-1-prop-2-enyl-3,5-dioxatricyclo[6.2.2.02,7]dodec-11-ene-10-carboxylate |
|---|---|
| PubChem CID | 122201892 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethyl (1S,2S,7R,8S,10S)-10-(methoxymethyl)-4,4-dimethyl-1-prop-2-enyl-3,5-dioxatricyclo[6.2.2.02,7]dodec-11-ene-10-carboxylate |
| SMILES | C=CC[C@]12C=C[C@H](C[C@]1(COC)C(=O)OCC)[C@@H]1COC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C20H30O5/c1-6-9-19-10-8-14(15-12-24-18(3,4)25-16(15)19)11-20(19,13-22-5)17(21)23-7-2/h6,8,10,14-16H,1,7,9,11-13H2,2-5H3/t14-,15+,16+,19-,20+/m1/s1 |
| InChIKey | CNPAYGHHICAYPK-GTXWJXBTSA-N |
| XLogP | 3.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|