C15H20O3 — CID 135036757
(1R,5S,9S,13R)-6,11,13-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-7-ene-4,10-dione (PubChem CID 135036757) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1R,5S,9S,13R)-6,11,13-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-7-ene-4,10-dione.
| Compound Name | (1R,5S,9S,13R)-6,11,13-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-7-ene-4,10-dione |
|---|---|
| PubChem CID | 135036757 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1R,5S,9S,13R)-6,11,13-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-7-ene-4,10-dione |
| SMILES | CC1C[C@H]2OCC(=O)[C@H]3C(C)C=C[C@H](C1=O)[C@@]23C |
| InChI | InChI=1S/C15H20O3/c1-8-4-5-10-14(17)9(2)6-12-15(10,3)13(8)11(16)7-18-12/h4-5,8-10,12-13H,6-7H2,1-3H3/t8?,9?,10-,12-,13-,15+/m1/s1 |
| InChIKey | YDNDLPBMZSMNRQ-YAAICBKDSA-N |
| XLogP | 2.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|