C19H28O3 — CID 11130518
[(2S,3R,4S,4aS,8aS)-3,4,8,8a-tetramethyl-1-oxo-4-prop-2-enyl-3,4a,5,6-tetrahydro-2H-naphthalen-2-yl] acetate (PubChem CID 11130518) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is [(2S,3R,4S,4aS,8aS)-3,4,8,8a-tetramethyl-1-oxo-4-prop-2-enyl-3,4a,5,6-tetrahydro-2H-naphthalen-2-yl] acetate.
| Compound Name | [(2S,3R,4S,4aS,8aS)-3,4,8,8a-tetramethyl-1-oxo-4-prop-2-enyl-3,4a,5,6-tetrahydro-2H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 11130518 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [(2S,3R,4S,4aS,8aS)-3,4,8,8a-tetramethyl-1-oxo-4-prop-2-enyl-3,4a,5,6-tetrahydro-2H-naphthalen-2-yl] acetate |
| SMILES | C=CC[C@@]1(C)[C@@H]2CCC=C(C)[C@@]2(C)C(=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C19H28O3/c1-7-11-18(5)13(3)16(22-14(4)20)17(21)19(6)12(2)9-8-10-15(18)19/h7,9,13,15-16H,1,8,10-11H2,2-6H3/t13-,15-,16-,18+,19+/m0/s1 |
| InChIKey | KXWYGBKLAKRWNN-MUMMTRGTSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|