C16H20O6 — CID 122214344
methyl 7,7-dimethoxy-8-oxo-1-[(E)-3-oxobut-1-enyl]bicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 122214344) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl 7,7-dimethoxy-8-oxo-1-[(E)-3-oxobut-1-enyl]bicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl 7,7-dimethoxy-8-oxo-1-[(E)-3-oxobut-1-enyl]bicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 122214344 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | methyl 7,7-dimethoxy-8-oxo-1-[(E)-3-oxobut-1-enyl]bicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)C1CC2C=CC1(/C=C/C(C)=O)C(OC)(OC)C2=O |
| InChI | InChI=1S/C16H20O6/c1-10(17)5-7-15-8-6-11(9-12(15)14(19)20-2)13(18)16(15,21-3)22-4/h5-8,11-12H,9H2,1-4H3/b7-5+ |
| InChIKey | WSOZKVPFJPIBQV-FNORWQNLSA-N |
| XLogP | 1.06 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|