C10H5Cl2NO2 — CID 102261451
5-chloro-2-(3-chlorophenyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 102261451) has the molecular formula C10H5Cl2NO2 and a molecular weight of 242.06 g/mol. Its IUPAC name is 5-chloro-2-(3-chlorophenyl)-1,3-oxazole-4-carbaldehyde.
| Compound Name | 5-chloro-2-(3-chlorophenyl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 102261451 |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 5-chloro-2-(3-chlorophenyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | O=Cc1nc(-c2cccc(Cl)c2)oc1Cl |
| InChI | InChI=1S/C10H5Cl2NO2/c11-7-3-1-2-6(4-7)10-13-8(5-14)9(12)15-10/h1-5H |
| InChIKey | RCYZUCDEGNKZBE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|