C26H17Cl2NOS — CID 102264889
4-[bis(4-chlorophenyl)methyl]-2-phenyl-5-thiophen-2-yl-1,3-oxazole (PubChem CID 102264889) has the molecular formula C26H17Cl2NOS and a molecular weight of 462.40 g/mol. Its IUPAC name is 4-[bis(4-chlorophenyl)methyl]-2-phenyl-5-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-[bis(4-chlorophenyl)methyl]-2-phenyl-5-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 102264889 |
| Molecular Formula | C26H17Cl2NOS |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 4-[bis(4-chlorophenyl)methyl]-2-phenyl-5-thiophen-2-yl-1,3-oxazole |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)c2nc(-c3ccccc3)oc2-c2cccs2)cc1 |
| InChI | InChI=1S/C26H17Cl2NOS/c27-20-12-8-17(9-13-20)23(18-10-14-21(28)15-11-18)24-25(22-7-4-16-31-22)30-26(29-24)19-5-2-1-3-6-19/h1-16,23H |
| InChIKey | WPQHGBHLTSEPPS-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |