C30H17ClOS3 — CID 155929966
2,4-bis(1-benzothiophen-2-yl)-3-(4-chlorophenyl)-5-thiophen-2-ylfuran (PubChem CID 155929966) has the molecular formula C30H17ClOS3 and a molecular weight of 525.12 g/mol. Its IUPAC name is 2,4-bis(1-benzothiophen-2-yl)-3-(4-chlorophenyl)-5-thiophen-2-ylfuran.
| Compound Name | 2,4-bis(1-benzothiophen-2-yl)-3-(4-chlorophenyl)-5-thiophen-2-ylfuran |
|---|---|
| PubChem CID | 155929966 |
| Molecular Formula | C30H17ClOS3 |
| Molecular Weight | 525.12 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | 2,4-bis(1-benzothiophen-2-yl)-3-(4-chlorophenyl)-5-thiophen-2-ylfuran |
| SMILES | Clc1ccc(-c2c(-c3cc4ccccc4s3)oc(-c3cccs3)c2-c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C30H17ClOS3/c31-21-13-11-18(12-14-21)27-28(25-16-19-6-1-3-8-22(19)34-25)29(24-10-5-15-33-24)32-30(27)26-17-20-7-2-4-9-23(20)35-26/h1-17H |
| InChIKey | OEQSTDKZGJZBAN-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.12 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |