C27H27NO — CID 102265017
(2S)-4,6,6-trimethyl-2-[2-(6-phenyl-2-pyridinyl)phenyl]bicyclo[3.1.1]hept-3-en-2-ol (PubChem CID 102265017) has the molecular formula C27H27NO and a molecular weight of 381.52 g/mol. Its IUPAC name is (2S)-4,6,6-trimethyl-2-[2-(6-phenyl-2-pyridinyl)phenyl]bicyclo[3.1.1]hept-3-en-2-ol.
| Compound Name | (2S)-4,6,6-trimethyl-2-[2-(6-phenyl-2-pyridinyl)phenyl]bicyclo[3.1.1]hept-3-en-2-ol |
|---|---|
| PubChem CID | 102265017 |
| Molecular Formula | C27H27NO |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (2S)-4,6,6-trimethyl-2-[2-(6-phenyl-2-pyridinyl)phenyl]bicyclo[3.1.1]hept-3-en-2-ol |
| SMILES | CC1=C[C@@](O)(c2ccccc2-c2cccc(-c3ccccc3)n2)C2CC1C2(C)C |
| InChI | InChI=1S/C27H27NO/c1-18-17-27(29,25-16-22(18)26(25,2)3)21-13-8-7-12-20(21)24-15-9-14-23(28-24)19-10-5-4-6-11-19/h4-15,17,22,25,29H,16H2,1-3H3/t22?,25?,27-/m1/s1 |
| InChIKey | UNVIYSMLOQFSFP-GHTCIJBCSA-N |
| XLogP | 6.23 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|