C20H28O9 — CID 102265153
methyl (1R,4R,6S)-4-[[(3aR,5R,6S,6aR)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 102265153) has the molecular formula C20H28O9 and a molecular weight of 412.44 g/mol. Its IUPAC name is methyl (1R,4R,6S)-4-[[(3aR,5R,6S,6aR)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | methyl (1R,4R,6S)-4-[[(3aR,5R,6S,6aR)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 102265153 |
| Molecular Formula | C20H28O9 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | methyl (1R,4R,6S)-4-[[(3aR,5R,6S,6aR)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2O[C@H]2C[C@H]1O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H28O9/c1-19(2)23-8-13(27-19)14-15(16-18(26-14)29-20(3,4)28-16)25-10-7-12-11(24-12)6-9(10)17(21)22-5/h6,10-16,18H,7-8H2,1-5H3/t10-,11-,12+,13+,14-,15+,16-,18-/m1/s1 |
| InChIKey | QVSJIBJDTDRNJO-NYTRXAONSA-N |
| XLogP | 1.04 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|